C15H18F2N2O2 — CID 108503869
N'-cyclohexyl-N-(2,4-difluorophenyl)-N'-methyloxamide (PubChem CID 108503869) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is N'-cyclohexyl-N-(2,4-difluorophenyl)-N'-methyloxamide.
| Compound Name | N'-cyclohexyl-N-(2,4-difluorophenyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 108503869 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N'-cyclohexyl-N-(2,4-difluorophenyl)-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C15H18F2N2O2/c1-19(11-5-3-2-4-6-11)15(21)14(20)18-13-8-7-10(16)9-12(13)17/h7-9,11H,2-6H2,1H3,(H,18,20) |
| InChIKey | HCHRIQWZXYVSPI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|