About N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide
N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide (PubChem CID 108503669) has the molecular formula C15H18ClN3O4
and a molecular weight of 339.78 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide.
Molecular Properties
| Compound Name | N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide |
| PubChem CID | 108503669 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H18ClN3O4/c1-18(10-5-3-2-4-6-10)15(21)14(20)17-13-9-11(19(22)23)7-8-12(13)16/h7-10H,2-6H2,1H3,(H,17,20) |
| InChIKey | PASKDFBQEHGOHE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide?
The IUPAC name of N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide (CID 108503669) is N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide.
What is the SMILES notation for N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide?
The canonical SMILES for N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide is CN(C(=O)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)C1CCCCC1.
What is the InChIKey of N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide?
The InChIKey is PASKDFBQEHGOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3O4/c1-18(10-5-3-2-4-6-10)15(21)14(20)17-13-9-11(19(22)23)7-8-12(13)16/h7-10H,2-6H2,1H3,(H,17,20).
What are the key properties of N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide?
N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide has a molecular weight of 339.78 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-5-nitrophenyl)-N'-cyclohexyl-N'-methyloxamide is sourced from PubChem (CID 108503669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).