C12H14ClN3O4S2 — CID 7504102
3-(2-chloro-5-nitrophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylthiourea (PubChem CID 7504102) has the molecular formula C12H14ClN3O4S2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-(2-chloro-5-nitrophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylthiourea.
| Compound Name | 3-(2-chloro-5-nitrophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylthiourea |
|---|---|
| PubChem CID | 7504102 |
| Molecular Formula | C12H14ClN3O4S2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 3-(2-chloro-5-nitrophenyl)-1-[(3R)-1,1-dioxothiolan-3-yl]-1-methylthiourea |
| SMILES | CN(C(=S)Nc1cc([N+](=O)[O-])ccc1Cl)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14ClN3O4S2/c1-15(9-4-5-22(19,20)7-9)12(21)14-11-6-8(16(17)18)2-3-10(11)13/h2-3,6,9H,4-5,7H2,1H3,(H,14,21)/t9-/m1/s1 |
| InChIKey | LXPQFYALKYLRPP-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|