C12H12ClN3O6S — CID 108513508
N'-(2-chloro-5-nitrophenyl)-N-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108513508) has the molecular formula C12H12ClN3O6S and a molecular weight of 361.76 g/mol. Its IUPAC name is N'-(2-chloro-5-nitrophenyl)-N-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N'-(2-chloro-5-nitrophenyl)-N-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108513508 |
| Molecular Formula | C12H12ClN3O6S |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N'-(2-chloro-5-nitrophenyl)-N-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12ClN3O6S/c13-9-2-1-8(16(19)20)5-10(9)15-12(18)11(17)14-7-3-4-23(21,22)6-7/h1-2,5,7H,3-4,6H2,(H,14,17)(H,15,18) |
| InChIKey | AFOVIGHVUCVLQY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|