C11H11ClN2O5S — CID 82781177
3-chloro-N-(1,1-dioxothiolan-3-yl)-4-nitrobenzamide (PubChem CID 82781177) has the molecular formula C11H11ClN2O5S and a molecular weight of 318.74 g/mol. Its IUPAC name is 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-nitrobenzamide.
| Compound Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 82781177 |
| Molecular Formula | C11H11ClN2O5S |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-chloro-N-(1,1-dioxothiolan-3-yl)-4-nitrobenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O5S/c12-9-5-7(1-2-10(9)14(16)17)11(15)13-8-3-4-20(18,19)6-8/h1-2,5,8H,3-4,6H2,(H,13,15) |
| InChIKey | OGWDHRYZBSMSBQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|