C11H10Cl2N2O5S — CID 43215623
3,4-dichloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzamide (PubChem CID 43215623) has the molecular formula C11H10Cl2N2O5S and a molecular weight of 353.18 g/mol. Its IUPAC name is 3,4-dichloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzamide.
| Compound Name | 3,4-dichloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 43215623 |
| Molecular Formula | C11H10Cl2N2O5S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3,4-dichloro-N-(1,1-dioxothiolan-3-yl)-5-nitrobenzamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10Cl2N2O5S/c12-8-3-6(4-9(10(8)13)15(17)18)11(16)14-7-1-2-21(19,20)5-7/h3-4,7H,1-2,5H2,(H,14,16) |
| InChIKey | FMTDRGZYKBYQDI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|