C16H21Cl2NO4S — CID 18848405
3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-pentoxybenzamide (PubChem CID 18848405) has the molecular formula C16H21Cl2NO4S and a molecular weight of 394.32 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18848405 |
| Molecular Formula | C16H21Cl2NO4S |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)NC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C16H21Cl2NO4S/c1-2-3-4-6-23-15-13(17)8-11(9-14(15)18)16(20)19-12-5-7-24(21,22)10-12/h8-9,12H,2-7,10H2,1H3,(H,19,20) |
| InChIKey | ZJYGRCCARLYLRE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|