C26H34Cl2N2O4S — CID 18848954
3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide (PubChem CID 18848954) has the molecular formula C26H34Cl2N2O4S and a molecular weight of 541.54 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 18848954 |
| Molecular Formula | C26H34Cl2N2O4S |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)N(Cc2ccc(N(C)C)cc2)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C26H34Cl2N2O4S/c1-4-5-6-7-13-34-25-23(27)15-20(16-24(25)28)26(31)30(22-12-14-35(32,33)18-22)17-19-8-10-21(11-9-19)29(2)3/h8-11,15-16,22H,4-7,12-14,17-18H2,1-3H3 |
| InChIKey | FRXLLHSTNGCSDL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|