C24H30Cl2N2O4S — CID 18848792
4-butoxy-3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 18848792) has the molecular formula C24H30Cl2N2O4S and a molecular weight of 513.49 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-butoxy-3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 18848792 |
| Molecular Formula | C24H30Cl2N2O4S |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 4-butoxy-3,5-dichloro-N-[[4-(dimethylamino)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N(Cc2ccc(N(C)C)cc2)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C24H30Cl2N2O4S/c1-4-5-11-32-23-21(25)13-18(14-22(23)26)24(29)28(20-10-12-33(30,31)16-20)15-17-6-8-19(9-7-17)27(2)3/h6-9,13-14,20H,4-5,10-12,15-16H2,1-3H3 |
| InChIKey | VAGKOVWOAXTOPD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|