C23H29Cl2NO5S — CID 18880218
3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 18880218) has the molecular formula C23H29Cl2NO5S and a molecular weight of 502.46 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 18880218 |
| Molecular Formula | C23H29Cl2NO5S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)N(Cc2ccc(C)o2)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C23H29Cl2NO5S/c1-3-4-5-6-10-30-22-20(24)12-17(13-21(22)25)23(27)26(14-19-8-7-16(2)31-19)18-9-11-32(28,29)15-18/h7-8,12-13,18H,3-6,9-11,14-15H2,1-2H3 |
| InChIKey | QAHHCHQDGHRYBQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|