C19H28ClNO5S — CID 55377242
N-butyl-3-chloro-N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-propoxybenzamide (PubChem CID 55377242) has the molecular formula C19H28ClNO5S and a molecular weight of 417.96 g/mol. Its IUPAC name is N-butyl-3-chloro-N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-propoxybenzamide.
| Compound Name | N-butyl-3-chloro-N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 55377242 |
| Molecular Formula | C19H28ClNO5S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-butyl-3-chloro-N-(1,1-dioxothiolan-3-yl)-5-methoxy-4-propoxybenzamide |
| SMILES | CCCCN(C(=O)c1cc(Cl)c(OCCC)c(OC)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H28ClNO5S/c1-4-6-8-21(15-7-10-27(23,24)13-15)19(22)14-11-16(20)18(26-9-5-2)17(12-14)25-3/h11-12,15H,4-10,13H2,1-3H3 |
| InChIKey | SAWKIEIBAYELKF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |