C24H29Cl2NO4S — CID 2954169
4-butoxy-3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-[(4-ethylphenyl)methyl]benzamide (PubChem CID 2954169) has the molecular formula C24H29Cl2NO4S and a molecular weight of 498.47 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-[(4-ethylphenyl)methyl]benzamide.
| Compound Name | 4-butoxy-3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-[(4-ethylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 2954169 |
| Molecular Formula | C24H29Cl2NO4S |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-butoxy-3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-N-[(4-ethylphenyl)methyl]benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)N(Cc2ccc(CC)cc2)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C24H29Cl2NO4S/c1-3-5-11-31-23-21(25)13-19(14-22(23)26)24(28)27(20-10-12-32(29,30)16-20)15-18-8-6-17(4-2)7-9-18/h6-9,13-14,20H,3-5,10-12,15-16H2,1-2H3 |
| InChIKey | AVSGJUWRHLIJQN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|