C27H35Cl2NO4S — CID 18848953
3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide (PubChem CID 18848953) has the molecular formula C27H35Cl2NO4S and a molecular weight of 540.55 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18848953 |
| Molecular Formula | C27H35Cl2NO4S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-hexoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)N(Cc2ccc(C(C)C)cc2)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C27H35Cl2NO4S/c1-4-5-6-7-13-34-26-24(28)15-22(16-25(26)29)27(31)30(23-12-14-35(32,33)18-23)17-20-8-10-21(11-9-20)19(2)3/h8-11,15-16,19,23H,4-7,12-14,17-18H2,1-3H3 |
| InChIKey | CYMYZGBWXVQLHB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|