C26H35NO4S — CID 41064869
N-[(3S)-1,1-dioxothiolan-3-yl]-4-pentoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide (PubChem CID 41064869) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-pentoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-pentoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 41064869 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-pentoxy-N-[(4-propan-2-ylphenyl)methyl]benzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(Cc2ccc(C(C)C)cc2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C26H35NO4S/c1-4-5-6-16-31-25-13-11-23(12-14-25)26(28)27(24-15-17-32(29,30)19-24)18-21-7-9-22(10-8-21)20(2)3/h7-14,20,24H,4-6,15-19H2,1-3H3/t24-/m0/s1 |
| InChIKey | NNGVUDOXGYBUGR-DEOSSOPVSA-N |
| XLogP | 5.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|