C27H37NO6S — CID 3786234
N-[(3,4-dimethoxyphenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-heptoxybenzamide (PubChem CID 3786234) has the molecular formula C27H37NO6S and a molecular weight of 503.66 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-heptoxybenzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-heptoxybenzamide |
|---|---|
| PubChem CID | 3786234 |
| Molecular Formula | C27H37NO6S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-(1,1-dioxothiolan-3-yl)-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)N(Cc2ccc(OC)c(OC)c2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C27H37NO6S/c1-4-5-6-7-8-16-34-24-12-10-22(11-13-24)27(29)28(23-15-17-35(30,31)20-23)19-21-9-14-25(32-2)26(18-21)33-3/h9-14,18,23H,4-8,15-17,19-20H2,1-3H3 |
| InChIKey | IAFDVLFDGSUWQH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|