C23H31NO4S2 — CID 27309374
N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(3-methylthiophen-2-yl)methyl]benzamide (PubChem CID 27309374) has the molecular formula C23H31NO4S2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(3-methylthiophen-2-yl)methyl]benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(3-methylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 27309374 |
| Molecular Formula | C23H31NO4S2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(3-methylthiophen-2-yl)methyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)N(Cc2sccc2C)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H31NO4S2/c1-3-4-5-6-13-28-21-9-7-19(8-10-21)23(25)24(16-22-18(2)11-14-29-22)20-12-15-30(26,27)17-20/h7-11,14,20H,3-6,12-13,15-17H2,1-2H3/t20-/m0/s1 |
| InChIKey | OSSGUOPKCGZJMM-FQEVSTJZSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|