C25H33NO5S — CID 41064961
N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 41064961) has the molecular formula C25H33NO5S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 41064961 |
| Molecular Formula | C25H33NO5S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-hexoxy-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)N(Cc2ccc(OC)cc2)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C25H33NO5S/c1-3-4-5-6-16-31-24-13-9-21(10-14-24)25(27)26(22-15-17-32(28,29)19-22)18-20-7-11-23(30-2)12-8-20/h7-14,22H,3-6,15-19H2,1-2H3/t22-/m0/s1 |
| InChIKey | BSAOXYUUCIQNCQ-QFIPXVFZSA-N |
| XLogP | 4.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|