C24H29NO5S — CID 18818019
N-(1,1-dioxothiolan-3-yl)-4-prop-2-enoxy-N-[(4-propoxyphenyl)methyl]benzamide (PubChem CID 18818019) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-prop-2-enoxy-N-[(4-propoxyphenyl)methyl]benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-prop-2-enoxy-N-[(4-propoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18818019 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-prop-2-enoxy-N-[(4-propoxyphenyl)methyl]benzamide |
| SMILES | C=CCOc1ccc(C(=O)N(Cc2ccc(OCCC)cc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H29NO5S/c1-3-14-29-22-9-5-19(6-10-22)17-25(21-13-16-31(27,28)18-21)24(26)20-7-11-23(12-8-20)30-15-4-2/h4-12,21H,2-3,13-18H2,1H3 |
| InChIKey | VVMRRXQLHSOPID-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|