C23H28ClNO4S — CID 41301092
N-[(3-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-4-pentoxybenzamide (PubChem CID 41301092) has the molecular formula C23H28ClNO4S and a molecular weight of 450.00 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-4-pentoxybenzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 41301092 |
| Molecular Formula | C23H28ClNO4S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(Cc2cccc(Cl)c2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C23H28ClNO4S/c1-2-3-4-13-29-22-10-8-19(9-11-22)23(26)25(21-12-14-30(27,28)17-21)16-18-6-5-7-20(24)15-18/h5-11,15,21H,2-4,12-14,16-17H2,1H3/t21-/m1/s1 |
| InChIKey | UNYXMIGEAZPSOL-OAQYLSRUSA-N |
| XLogP | 4.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|