C30H33Cl2NO4S — CID 18818005
N-[[4-(2,4-dichlorophenyl)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide (PubChem CID 18818005) has the molecular formula C30H33Cl2NO4S and a molecular weight of 574.57 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenyl)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide.
| Compound Name | N-[[4-(2,4-dichlorophenyl)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 18818005 |
| Molecular Formula | C30H33Cl2NO4S |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | N-[[4-(2,4-dichlorophenyl)phenyl]methyl]-N-(1,1-dioxothiolan-3-yl)-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)N(Cc2ccc(-c3ccc(Cl)cc3Cl)cc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C30H33Cl2NO4S/c1-2-3-4-5-17-37-27-13-10-24(11-14-27)30(34)33(26-16-18-38(35,36)21-26)20-22-6-8-23(9-7-22)28-15-12-25(31)19-29(28)32/h6-15,19,26H,2-5,16-18,20-21H2,1H3 |
| InChIKey | NEMKIBKGJYDDHI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|