C15H19Cl2NO4S — CID 78816353
3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-propylbenzamide (PubChem CID 78816353) has the molecular formula C15H19Cl2NO4S and a molecular weight of 380.29 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-propylbenzamide.
| Compound Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-propylbenzamide |
|---|---|
| PubChem CID | 78816353 |
| Molecular Formula | C15H19Cl2NO4S |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1cc(Cl)c(OC)c(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19Cl2NO4S/c1-3-5-18(11-4-6-23(20,21)9-11)15(19)10-7-12(16)14(22-2)13(17)8-10/h7-8,11H,3-6,9H2,1-2H3 |
| InChIKey | ALVNXHOYMBUDAF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |