C13H15Cl2NO4S — CID 24679446
3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-methylbenzamide (PubChem CID 24679446) has the molecular formula C13H15Cl2NO4S and a molecular weight of 352.24 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 24679446 |
| Molecular Formula | C13H15Cl2NO4S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 3,5-dichloro-N-(1,1-dioxothiolan-3-yl)-4-methoxy-N-methylbenzamide |
| SMILES | COc1c(Cl)cc(C(=O)N(C)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO4S/c1-16(9-3-4-21(18,19)7-9)13(17)8-5-10(14)12(20-2)11(15)6-8/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | LFJKMFJHSVURKO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |