C13H17NO3S — CID 7430109
N-[(3R)-1,1-dioxothiolan-3-yl]-N,4-dimethylbenzamide (PubChem CID 7430109) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N,4-dimethylbenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 7430109 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-10-3-5-11(6-4-10)13(15)14(2)12-7-8-18(16,17)9-12/h3-6,12H,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | KXIAIEVEICJQOZ-GFCCVEGCSA-N |
| XLogP | 1.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |