C11H13NO5S — CID 110697472
N-(1,1-dioxothiolan-3-yl)-N-methyl-6-oxopyran-3-carboxamide (PubChem CID 110697472) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-6-oxopyran-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 110697472 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-6-oxopyran-3-carboxamide |
| SMILES | CN(C(=O)c1ccc(=O)oc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13NO5S/c1-12(9-4-5-18(15,16)7-9)11(14)8-2-3-10(13)17-6-8/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | VVQJNMSPZVIMIH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |