C12H15NO5S — CID 110697481
N-(1,1-dioxothiolan-3-yl)-N-ethyl-6-oxopyran-3-carboxamide (PubChem CID 110697481) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-6-oxopyran-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 110697481 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-6-oxopyran-3-carboxamide |
| SMILES | CCN(C(=O)c1ccc(=O)oc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15NO5S/c1-2-13(10-5-6-19(16,17)8-10)12(15)9-3-4-11(14)18-7-9/h3-4,7,10H,2,5-6,8H2,1H3 |
| InChIKey | CJNZKSBTYIPJNG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |