C13H16BrNO3S — CID 7259739
4-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylbenzamide (PubChem CID 7259739) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is 4-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylbenzamide.
| Compound Name | 4-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 7259739 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 4-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Br)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16BrNO3S/c1-2-15(12-7-8-19(17,18)9-12)13(16)10-3-5-11(14)6-4-10/h3-6,12H,2,7-9H2,1H3/t12-/m1/s1 |
| InChIKey | CGAXODUKLJELJZ-GFCCVEGCSA-N |
| XLogP | 2.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |