C17H19NO3S — CID 9245593
N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylnaphthalene-2-carboxamide (PubChem CID 9245593) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylnaphthalene-2-carboxamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 9245593 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethylnaphthalene-2-carboxamide |
| SMILES | CCN(C(=O)c1ccc2ccccc2c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H19NO3S/c1-2-18(16-9-10-22(20,21)12-16)17(19)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11,16H,2,9-10,12H2,1H3/t16-/m1/s1 |
| InChIKey | OOMWCFBFVKGXBY-MRXNPFEDSA-N |
| XLogP | 2.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |