C18H28N2O5S2 — CID 97028486
3-(diethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-methylbenzamide (PubChem CID 97028486) has the molecular formula C18H28N2O5S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-methylbenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 97028486 |
| Molecular Formula | C18H28N2O5S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]-N-ethyl-4-methylbenzamide |
| SMILES | CCN(C(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H28N2O5S2/c1-5-19(6-2)27(24,25)17-12-15(9-8-14(17)4)18(21)20(7-3)16-10-11-26(22,23)13-16/h8-9,12,16H,5-7,10-11,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | ZRBFQFKHZVKUJP-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |