C16H23NO6S2 — CID 129360457
3-[butyl-[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-methylbenzoic acid (PubChem CID 129360457) has the molecular formula C16H23NO6S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[butyl-[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[butyl-[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 129360457 |
| Molecular Formula | C16H23NO6S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-[butyl-[(3S)-1,1-dioxothiolan-3-yl]sulfamoyl]-4-methylbenzoic acid |
| SMILES | CCCCN([C@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C16H23NO6S2/c1-3-4-8-17(14-7-9-24(20,21)11-14)25(22,23)15-10-13(16(18)19)6-5-12(15)2/h5-6,10,14H,3-4,7-9,11H2,1-2H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | VVQGXMXTILEDSZ-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |