C9H19NO4S2 — CID 7260297
N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]methanesulfonamide (PubChem CID 7260297) has the molecular formula C9H19NO4S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]methanesulfonamide.
| Compound Name | N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 7260297 |
| Molecular Formula | C9H19NO4S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]methanesulfonamide |
| SMILES | CCCCN([C@@H]1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C9H19NO4S2/c1-3-4-6-10(15(2,11)12)9-5-7-16(13,14)8-9/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | VMFDLSVZMOPWHH-SECBINFHSA-N |
| XLogP | 0.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |