C15H23NO4S2 — CID 7452405
N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-4-methylbenzenesulfonamide (PubChem CID 7452405) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 7452405 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-butyl-N-[(3R)-1,1-dioxothiolan-3-yl]-4-methylbenzenesulfonamide |
| SMILES | CCCCN([C@@H]1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H23NO4S2/c1-3-4-10-16(14-9-11-21(17,18)12-14)22(19,20)15-7-5-13(2)6-8-15/h5-8,14H,3-4,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | JIINOMOOPDSPQZ-CQSZACIVSA-N |
| XLogP | 1.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |