C15H20N2O4S2 — CID 129370560
N-butyl-3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]benzenesulfonamide (PubChem CID 129370560) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-butyl-3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]benzenesulfonamide.
| Compound Name | N-butyl-3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 129370560 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-butyl-3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]benzenesulfonamide |
| SMILES | CCCCN([C@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C15H20N2O4S2/c1-2-3-8-17(14-7-9-22(18,19)12-14)23(20,21)15-6-4-5-13(10-15)11-16/h4-6,10,14H,2-3,7-9,12H2,1H3/t14-/m0/s1 |
| InChIKey | VIGPCPZKFLWYGI-AWEZNQCLSA-N |
| XLogP | 1.54 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |