C14H16N2O4S2 — CID 129368139
3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 129368139) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 129368139 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN([C@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-2-7-16(13-6-8-21(17,18)11-13)22(19,20)14-5-3-4-12(9-14)10-15/h2-5,9,13H,1,6-8,11H2/t13-/m0/s1 |
| InChIKey | IPCGROAGZCFGNA-ZDUSSCGKSA-N |
| XLogP | 0.92 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|