C12H14N2O4S2 — CID 47023234
3-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]benzenesulfonamide (PubChem CID 47023234) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47023234 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-cyano-N-[(1,1-dioxothiolan-3-yl)methyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)NCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H14N2O4S2/c13-7-10-2-1-3-12(6-10)20(17,18)14-8-11-4-5-19(15,16)9-11/h1-3,6,11,14H,4-5,8-9H2 |
| InChIKey | LESOUCALTKQFQX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |