C15H23N3O5S2 — CID 74243722
3-[(1,1-dioxothiolan-3-yl)methylsulfamoyl]-N-[2-(methylamino)ethyl]benzamide (PubChem CID 74243722) has the molecular formula C15H23N3O5S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylsulfamoyl]-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylsulfamoyl]-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 74243722 |
| Molecular Formula | C15H23N3O5S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylsulfamoyl]-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cccc(S(=O)(=O)NCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H23N3O5S2/c1-16-6-7-17-15(19)13-3-2-4-14(9-13)25(22,23)18-10-12-5-8-24(20,21)11-12/h2-4,9,12,16,18H,5-8,10-11H2,1H3,(H,17,19) |
| InChIKey | PTLUERWECWLDJM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|