C15H24ClN3O3S — CID 119508576
3-(cyclopropylmethylsulfamoyl)-N-[2-(ethylamino)ethyl]benzamide;hydrochloride (PubChem CID 119508576) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-[2-(ethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119508576 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cccc(S(=O)(=O)NCC2CC2)c1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-2-16-8-9-17-15(19)13-4-3-5-14(10-13)22(20,21)18-11-12-6-7-12;/h3-5,10,12,16,18H,2,6-9,11H2,1H3,(H,17,19);1H |
| InChIKey | VESJPKGNCJTONA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|