C14H24ClN3O4S — CID 119504724
N-[2-(ethylamino)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119504724) has the molecular formula C14H24ClN3O4S and a molecular weight of 365.88 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119504724 |
| Molecular Formula | C14H24ClN3O4S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cccc(S(=O)(=O)NCCOC)c1.Cl |
| InChI | InChI=1S/C14H23N3O4S.ClH/c1-3-15-7-8-16-14(18)12-5-4-6-13(11-12)22(19,20)17-9-10-21-2;/h4-6,11,15,17H,3,7-10H2,1-2H3,(H,16,18);1H |
| InChIKey | KFYCRIDJDRPFEV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|