C25H26N2O3S — CID 56523768
3-(cyclopropylmethylsulfamoyl)-N-(1,1-diphenylethyl)benzamide (PubChem CID 56523768) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-(1,1-diphenylethyl)benzamide.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-(1,1-diphenylethyl)benzamide |
|---|---|
| PubChem CID | 56523768 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-(1,1-diphenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)NCC2CC2)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3S/c1-25(21-10-4-2-5-11-21,22-12-6-3-7-13-22)27-24(28)20-9-8-14-23(17-20)31(29,30)26-18-19-15-16-19/h2-14,17,19,26H,15-16,18H2,1H3,(H,27,28) |
| InChIKey | FQWZTQAPSXOGJE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |