C18H20N4O4S — CID 37027882
N-[4-(carbamoylamino)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide (PubChem CID 37027882) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[4-(carbamoylamino)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide.
| Compound Name | N-[4-(carbamoylamino)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 37027882 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[4-(carbamoylamino)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
| SMILES | NC(=O)Nc1ccc(NC(=O)c2cccc(S(=O)(=O)NCC3CC3)c2)cc1 |
| InChI | InChI=1S/C18H20N4O4S/c19-18(24)22-15-8-6-14(7-9-15)21-17(23)13-2-1-3-16(10-13)27(25,26)20-11-12-4-5-12/h1-3,6-10,12,20H,4-5,11H2,(H,21,23)(H3,19,22,24) |
| InChIKey | LAWSLSCVPUWMRZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |