C18H28ClN3O3S — CID 119611856
N-[2-(aminomethyl)cyclohexyl]-3-(cyclopropylmethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119611856) has the molecular formula C18H28ClN3O3S and a molecular weight of 401.96 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-3-(cyclopropylmethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-3-(cyclopropylmethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119611856 |
| Molecular Formula | C18H28ClN3O3S |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-3-(cyclopropylmethylsulfamoyl)benzamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1cccc(S(=O)(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C18H27N3O3S.ClH/c19-11-15-4-1-2-7-17(15)21-18(22)14-5-3-6-16(10-14)25(23,24)20-12-13-8-9-13;/h3,5-6,10,13,15,17,20H,1-2,4,7-9,11-12,19H2,(H,21,22);1H |
| InChIKey | KGZURXTWAXDGBI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |