C19H19N3O4S — CID 37021657
3-(cyclopropylmethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide (PubChem CID 37021657) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 37021657 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-(2-methyl-1,3-benzoxazol-5-yl)benzamide |
| SMILES | Cc1nc2cc(NC(=O)c3cccc(S(=O)(=O)NCC4CC4)c3)ccc2o1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-21-17-10-15(7-8-18(17)26-12)22-19(23)14-3-2-4-16(9-14)27(24,25)20-11-13-5-6-13/h2-4,7-10,13,20H,5-6,11H2,1H3,(H,22,23) |
| InChIKey | LFMMSBMJQKGVPJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |