C23H29N3O3S — CID 55597646
N-[4-(azepan-1-yl)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide (PubChem CID 55597646) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55597646 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-3-(cyclopropylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCCC2)cc1)c1cccc(S(=O)(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C23H29N3O3S/c27-23(19-6-5-7-22(16-19)30(28,29)24-17-18-8-9-18)25-20-10-12-21(13-11-20)26-14-3-1-2-4-15-26/h5-7,10-13,16,18,24H,1-4,8-9,14-15,17H2,(H,25,27) |
| InChIKey | QVAROZBPDNMHCW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|