C23H29N3O4S — CID 55956827
N-(cyclopropylmethyl)-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]benzenesulfonamide (PubChem CID 55956827) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(cyclopropylmethyl)-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55956827 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-(cyclopropylmethyl)-3-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3cccc(S(=O)(=O)NCC4CC4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-30-21-10-8-20(9-11-21)25-12-3-13-26(15-14-25)23(27)19-4-2-5-22(16-19)31(28,29)24-17-18-6-7-18/h2,4-5,8-11,16,18,24H,3,6-7,12-15,17H2,1H3 |
| InChIKey | GPWCDYGWKOJTSA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|