C21H27N3O5S — CID 55566298
N-(2-methoxyethyl)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 55566298) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55566298 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-(2-methoxyethyl)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)N2CCN(c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C21H27N3O5S/c1-28-15-10-22-30(26,27)20-5-3-4-17(16-20)21(25)24-13-11-23(12-14-24)18-6-8-19(29-2)9-7-18/h3-9,16,22H,10-15H2,1-2H3 |
| InChIKey | UKPUTZIBUYKOQG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|