C24H33N3O8S — CID 46088510
4-methoxy-N-(2-methoxyethyl)-3-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzenesulfonamide (PubChem CID 46088510) has the molecular formula C24H33N3O8S and a molecular weight of 523.61 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-3-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-3-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 46088510 |
| Molecular Formula | C24H33N3O8S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-3-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OC)c(N2CCN(C(=O)c3cc(OC)c(OC)c(OC)c3)CC2)c1 |
| InChI | InChI=1S/C24H33N3O8S/c1-31-13-8-25-36(29,30)18-6-7-20(32-2)19(16-18)26-9-11-27(12-10-26)24(28)17-14-21(33-3)23(35-5)22(15-17)34-4/h6-7,14-16,25H,8-13H2,1-5H3 |
| InChIKey | JUKWMRLJUWYWQC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|