C20H25Cl2N3O6S2 — CID 46088867
3-[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-methoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 46088867) has the molecular formula C20H25Cl2N3O6S2 and a molecular weight of 538.48 g/mol. Its IUPAC name is 3-[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-methoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 3-[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46088867 |
| Molecular Formula | C20H25Cl2N3O6S2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 3-[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]-4-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OC)c(N2CCN(S(=O)(=O)c3cc(Cl)cc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C20H25Cl2N3O6S2/c1-30-10-5-23-32(26,27)17-3-4-20(31-2)19(14-17)24-6-8-25(9-7-24)33(28,29)18-12-15(21)11-16(22)13-18/h3-4,11-14,23H,5-10H2,1-2H3 |
| InChIKey | SETSYDBJYZSKSO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|