C21H26F3N3O6S2 — CID 46088866
4-methoxy-N-(2-methoxyethyl)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]benzenesulfonamide (PubChem CID 46088866) has the molecular formula C21H26F3N3O6S2 and a molecular weight of 537.58 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 46088866 |
| Molecular Formula | C21H26F3N3O6S2 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-3-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OC)c(N2CCN(S(=O)(=O)c3ccccc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C21H26F3N3O6S2/c1-32-14-9-25-34(28,29)16-7-8-19(33-2)18(15-16)26-10-12-27(13-11-26)35(30,31)20-6-4-3-5-17(20)21(22,23)24/h3-8,15,25H,9-14H2,1-2H3 |
| InChIKey | SAMKVTJOKQAFNT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|