C21H26ClN3O6S2 — CID 46088188
4-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-4-methoxyphenyl]sulfonylmorpholine (PubChem CID 46088188) has the molecular formula C21H26ClN3O6S2 and a molecular weight of 516.04 g/mol. Its IUPAC name is 4-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-4-methoxyphenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-4-methoxyphenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 46088188 |
| Molecular Formula | C21H26ClN3O6S2 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 4-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]-4-methoxyphenyl]sulfonylmorpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H26ClN3O6S2/c1-30-21-7-6-19(33(28,29)25-12-14-31-15-13-25)16-20(21)23-8-10-24(11-9-23)32(26,27)18-4-2-17(22)3-5-18/h2-7,16H,8-15H2,1H3 |
| InChIKey | YSRSXEWGOCKDDN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |