C18H22N2O4S — CID 113077853
1-(benzenesulfonyl)-4-(2,5-dimethoxyphenyl)piperazine (PubChem CID 113077853) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(2,5-dimethoxyphenyl)piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-(2,5-dimethoxyphenyl)piperazine |
|---|---|
| PubChem CID | 113077853 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(2,5-dimethoxyphenyl)piperazine |
| SMILES | COc1ccc(OC)c(N2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-23-15-8-9-18(24-2)17(14-15)19-10-12-20(13-11-19)25(21,22)16-6-4-3-5-7-16/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | JAAFKBMRBFSDGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |