C18H21ClN2O3S — CID 113080654
1-(benzenesulfonyl)-4-(4-chloro-2-methoxy-5-methylphenyl)piperazine (PubChem CID 113080654) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(4-chloro-2-methoxy-5-methylphenyl)piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-(4-chloro-2-methoxy-5-methylphenyl)piperazine |
|---|---|
| PubChem CID | 113080654 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(4-chloro-2-methoxy-5-methylphenyl)piperazine |
| SMILES | COc1cc(Cl)c(C)cc1N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-14-12-17(18(24-2)13-16(14)19)20-8-10-21(11-9-20)25(22,23)15-6-4-3-5-7-15/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | GMEAJDTZJXNYRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |